C19H26O4 — CID 75081697
1-(4-hydroxy-3-methoxyphenyl)dodec-1-ene-3,5-dione (PubChem CID 75081697) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methoxyphenyl)dodec-1-ene-3,5-dione.
| Compound Name | 1-(4-hydroxy-3-methoxyphenyl)dodec-1-ene-3,5-dione |
|---|---|
| PubChem CID | 75081697 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)dodec-1-ene-3,5-dione |
| SMILES | CCCCCCCC(=O)CC(=O)C=Cc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C19H26O4/c1-3-4-5-6-7-8-16(20)14-17(21)11-9-15-10-12-18(22)19(13-15)23-2/h9-13,22H,3-8,14H2,1-2H3 |
| InChIKey | QOJHXMDTWFYFRL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|