C40H44O6 — CID 175027137
(1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione;1-phenylheptylbenzene (PubChem CID 175027137) has the molecular formula C40H44O6 and a molecular weight of 620.79 g/mol. Its IUPAC name is (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione;1-phenylheptylbenzene.
| Compound Name | (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione;1-phenylheptylbenzene |
|---|---|
| PubChem CID | 175027137 |
| Molecular Formula | C40H44O6 |
| Molecular Weight | 620.79 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione;1-phenylheptylbenzene |
| SMILES | CCCCCCC(c1ccccc1)c1ccccc1.COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H20O6.C19H24/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2;1-2-3-4-11-16-19(17-12-7-5-8-13-17)18-14-9-6-10-15-18/h3-12,24-25H,13H2,1-2H3;5-10,12-15,19H,2-4,11,16H2,1H3/b7-3+,8-4+; |
| InChIKey | YBDMBJNDMMCKOD-UQXJJJGTSA-N |
| XLogP | 9.16 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.79 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|