C19H20O4 — CID 175420091
1-phenylpropyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 175420091) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-phenylpropyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | 1-phenylpropyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 175420091 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-phenylpropyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | CCC(OC(=O)C=Cc1ccc(O)c(OC)c1)c1ccccc1 |
| InChI | InChI=1S/C19H20O4/c1-3-17(15-7-5-4-6-8-15)23-19(21)12-10-14-9-11-16(20)18(13-14)22-2/h4-13,17,20H,3H2,1-2H3 |
| InChIKey | QXXZQBZGEVKSDO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|