C18H18O4 — CID 20980889
1-phenylethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 20980889) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 1-phenylethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | 1-phenylethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 20980889 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-phenylethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OC(C)c2ccccc2)ccc1O |
| InChI | InChI=1S/C18H18O4/c1-13(15-6-4-3-5-7-15)22-18(20)11-9-14-8-10-16(19)17(12-14)21-2/h3-13,19H,1-2H3 |
| InChIKey | BPTFVWMUEOUQDB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|