About ethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;naphthalene
ethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;naphthalene (PubChem CID 175420096) has the molecular formula C22H22O4
and a molecular weight of 350.41 g/mol. Its IUPAC name is ethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;naphthalene.
Molecular Properties
| Compound Name | ethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;naphthalene |
| PubChem CID | 175420096 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | ethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;naphthalene |
| SMILES | CCOC(=O)C=Cc1ccc(O)c(OC)c1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H14O4.C10H8/c1-3-16-12(14)7-5-9-4-6-10(13)11(8-9)15-2;1-2-6-10-8-4-3-7-9(10)5-1/h4-8,13H,3H2,1-2H3;1-8H |
| InChIKey | KWQHIUJLUVXKLF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;naphthalene?
The IUPAC name of ethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;naphthalene (CID 175420096) is ethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;naphthalene.
What is the SMILES notation for ethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;naphthalene?
The canonical SMILES for ethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;naphthalene is CCOC(=O)C=Cc1ccc(O)c(OC)c1.c1ccc2ccccc2c1.
What is the InChIKey of ethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;naphthalene?
The InChIKey is KWQHIUJLUVXKLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4.C10H8/c1-3-16-12(14)7-5-9-4-6-10(13)11(8-9)15-2;1-2-6-10-8-4-3-7-9(10)5-1/h4-8,13H,3H2,1-2H3;1-8H.
What are the key properties of ethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;naphthalene?
ethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;naphthalene has a molecular weight of 350.41 g/mol, XLogP of 4.82, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;naphthalene is sourced from PubChem (CID 175420096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).