C36H48N2O7 — CID 127034968
(2E,6E)-2,6-bis[[3-methoxy-4-(3-morpholin-4-ylpropoxy)phenyl]methylidene]cyclohexan-1-one (PubChem CID 127034968) has the molecular formula C36H48N2O7 and a molecular weight of 620.79 g/mol. Its IUPAC name is (2E,6E)-2,6-bis[[3-methoxy-4-(3-morpholin-4-ylpropoxy)phenyl]methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2,6-bis[[3-methoxy-4-(3-morpholin-4-ylpropoxy)phenyl]methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 127034968 |
| Molecular Formula | C36H48N2O7 |
| Molecular Weight | 620.79 g/mol |
| Exact Mass | 620.35 |
| IUPAC Name | (2E,6E)-2,6-bis[[3-methoxy-4-(3-morpholin-4-ylpropoxy)phenyl]methylidene]cyclohexan-1-one |
| SMILES | COc1cc(/C=C2\CCC/C(=C\c3ccc(OCCCN4CCOCC4)c(OC)c3)C2=O)ccc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C36H48N2O7/c1-40-34-26-28(8-10-32(34)44-18-4-12-37-14-20-42-21-15-37)24-30-6-3-7-31(36(30)39)25-29-9-11-33(35(27-29)41-2)45-19-5-13-38-16-22-43-23-17-38/h8-11,24-27H,3-7,12-23H2,1-2H3/b30-24+,31-25+ |
| InChIKey | BIVMWCAYEZIMNB-AMLXCYGQSA-N |
| XLogP | 5.13 |
| TPSA | 78.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.79 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|