C25H28O7 — CID 19577762
(2Z,5E)-2,5-bis[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methylidene]cyclopentan-1-one (PubChem CID 19577762) has the molecular formula C25H28O7 and a molecular weight of 440.49 g/mol. Its IUPAC name is (2Z,5E)-2,5-bis[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methylidene]cyclopentan-1-one.
| Compound Name | (2Z,5E)-2,5-bis[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 19577762 |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (2Z,5E)-2,5-bis[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methylidene]cyclopentan-1-one |
| SMILES | COc1cc(/C=C2/CC/C(=C\c3ccc(OCCO)c(OC)c3)C2=O)ccc1OCCO |
| InChI | InChI=1S/C25H28O7/c1-29-23-15-17(3-7-21(23)31-11-9-26)13-19-5-6-20(25(19)28)14-18-4-8-22(32-12-10-27)24(16-18)30-2/h3-4,7-8,13-16,26-27H,5-6,9-12H2,1-2H3/b19-13-,20-14+ |
| InChIKey | PGWQQIFDEYGVQV-LRVMPXQBSA-N |
| XLogP | 3.28 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|