C34H37NO5S — CID 155530851
(3E,5E)-1-(benzenecarbonothioyl)-3,5-bis[(3-methoxy-4-propoxyphenyl)methylidene]piperidin-4-one (PubChem CID 155530851) has the molecular formula C34H37NO5S and a molecular weight of 571.74 g/mol. Its IUPAC name is (3E,5E)-1-(benzenecarbonothioyl)-3,5-bis[(3-methoxy-4-propoxyphenyl)methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-1-(benzenecarbonothioyl)-3,5-bis[(3-methoxy-4-propoxyphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 155530851 |
| Molecular Formula | C34H37NO5S |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | (3E,5E)-1-(benzenecarbonothioyl)-3,5-bis[(3-methoxy-4-propoxyphenyl)methylidene]piperidin-4-one |
| SMILES | CCCOc1ccc(/C=C2\CN(C(=S)c3ccccc3)C/C(=C\c3ccc(OCCC)c(OC)c3)C2=O)cc1OC |
| InChI | InChI=1S/C34H37NO5S/c1-5-16-39-29-14-12-24(20-31(29)37-3)18-27-22-35(34(41)26-10-8-7-9-11-26)23-28(33(27)36)19-25-13-15-30(40-17-6-2)32(21-25)38-4/h7-15,18-21H,5-6,16-17,22-23H2,1-4H3/b27-18+,28-19+ |
| InChIKey | QBQAJQGTUDNSFA-UKOHILRMSA-N |
| XLogP | 7.01 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|