C29H36O5 — CID 19616429
(2E,6E)-2,6-bis[(3-methoxy-4-propoxyphenyl)methylidene]-4-methylcyclohexan-1-one (PubChem CID 19616429) has the molecular formula C29H36O5 and a molecular weight of 464.60 g/mol. Its IUPAC name is (2E,6E)-2,6-bis[(3-methoxy-4-propoxyphenyl)methylidene]-4-methylcyclohexan-1-one.
| Compound Name | (2E,6E)-2,6-bis[(3-methoxy-4-propoxyphenyl)methylidene]-4-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 19616429 |
| Molecular Formula | C29H36O5 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | (2E,6E)-2,6-bis[(3-methoxy-4-propoxyphenyl)methylidene]-4-methylcyclohexan-1-one |
| SMILES | CCCOc1ccc(/C=C2\CC(C)C/C(=C\c3ccc(OCCC)c(OC)c3)C2=O)cc1OC |
| InChI | InChI=1S/C29H36O5/c1-6-12-33-25-10-8-21(18-27(25)31-4)16-23-14-20(3)15-24(29(23)30)17-22-9-11-26(34-13-7-2)28(19-22)32-5/h8-11,16-20H,6-7,12-15H2,1-5H3/b23-16+,24-17+ |
| InChIKey | QZEVTDDKFOXMNU-WPHIWBHXSA-N |
| XLogP | 6.75 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|