C32H42O5 — CID 46505888
(2E,6E)-4-tert-butyl-2,6-bis[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]cyclohexan-1-one (PubChem CID 46505888) has the molecular formula C32H42O5 and a molecular weight of 506.68 g/mol. Its IUPAC name is (2E,6E)-4-tert-butyl-2,6-bis[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-4-tert-butyl-2,6-bis[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 46505888 |
| Molecular Formula | C32H42O5 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | (2E,6E)-4-tert-butyl-2,6-bis[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]cyclohexan-1-one |
| SMILES | COc1cc(/C=C2\CC(C(C)(C)C)C/C(=C\c3ccc(OC(C)C)c(OC)c3)C2=O)ccc1OC(C)C |
| InChI | InChI=1S/C32H42O5/c1-20(2)36-27-12-10-22(16-29(27)34-8)14-24-18-26(32(5,6)7)19-25(31(24)33)15-23-11-13-28(37-21(3)4)30(17-23)35-9/h10-17,20-21,26H,18-19H2,1-9H3/b24-14+,25-15+ |
| InChIKey | UVNBTZZHSNTBOT-KOJZRSEWSA-N |
| XLogP | 7.77 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|