C24H24Br2O — CID 6380226
(2Z,6E)-2,6-bis[(4-bromophenyl)methylidene]-4-tert-butylcyclohexan-1-one (PubChem CID 6380226) has the molecular formula C24H24Br2O and a molecular weight of 488.26 g/mol. Its IUPAC name is (2Z,6E)-2,6-bis[(4-bromophenyl)methylidene]-4-tert-butylcyclohexan-1-one.
| Compound Name | (2Z,6E)-2,6-bis[(4-bromophenyl)methylidene]-4-tert-butylcyclohexan-1-one |
|---|---|
| PubChem CID | 6380226 |
| Molecular Formula | C24H24Br2O |
| Molecular Weight | 488.26 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | (2Z,6E)-2,6-bis[(4-bromophenyl)methylidene]-4-tert-butylcyclohexan-1-one |
| SMILES | CC(C)(C)C1C/C(=C/c2ccc(Br)cc2)C(=O)/C(=C/c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C24H24Br2O/c1-24(2,3)20-14-18(12-16-4-8-21(25)9-5-16)23(27)19(15-20)13-17-6-10-22(26)11-7-17/h4-13,20H,14-15H2,1-3H3/b18-12-,19-13+ |
| InChIKey | KMSRZQWUGNAALE-MGYAYREDSA-N |
| XLogP | 7.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.26 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|