C29H36O — CID 17370191
(2Z,6E)-2,6-bis[(4-tert-butylphenyl)methylidene]-4-methylcyclohexan-1-one (PubChem CID 17370191) has the molecular formula C29H36O and a molecular weight of 400.61 g/mol. Its IUPAC name is (2Z,6E)-2,6-bis[(4-tert-butylphenyl)methylidene]-4-methylcyclohexan-1-one.
| Compound Name | (2Z,6E)-2,6-bis[(4-tert-butylphenyl)methylidene]-4-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 17370191 |
| Molecular Formula | C29H36O |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | (2Z,6E)-2,6-bis[(4-tert-butylphenyl)methylidene]-4-methylcyclohexan-1-one |
| SMILES | CC1C/C(=C/c2ccc(C(C)(C)C)cc2)C(=O)/C(=C/c2ccc(C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C29H36O/c1-20-16-23(18-21-8-12-25(13-9-21)28(2,3)4)27(30)24(17-20)19-22-10-14-26(15-11-22)29(5,6)7/h8-15,18-20H,16-17H2,1-7H3/b23-18-,24-19+ |
| InChIKey | GMNUNQGWJIIMIZ-XPKROWLPSA-N |
| XLogP | 7.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|