C25H24O5 — CID 2444541
methyl 4-[(E)-[(3E)-3-[(4-methoxycarbonylphenyl)methylidene]-5-methyl-2-oxocyclohexylidene]methyl]benzoate (PubChem CID 2444541) has the molecular formula C25H24O5 and a molecular weight of 404.46 g/mol. Its IUPAC name is methyl 4-[(E)-[(3E)-3-[(4-methoxycarbonylphenyl)methylidene]-5-methyl-2-oxocyclohexylidene]methyl]benzoate.
| Compound Name | methyl 4-[(E)-[(3E)-3-[(4-methoxycarbonylphenyl)methylidene]-5-methyl-2-oxocyclohexylidene]methyl]benzoate |
|---|---|
| PubChem CID | 2444541 |
| Molecular Formula | C25H24O5 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | methyl 4-[(E)-[(3E)-3-[(4-methoxycarbonylphenyl)methylidene]-5-methyl-2-oxocyclohexylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C2\CC(C)C/C(=C\c3ccc(C(=O)OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H24O5/c1-16-12-21(14-17-4-8-19(9-5-17)24(27)29-2)23(26)22(13-16)15-18-6-10-20(11-7-18)25(28)30-3/h4-11,14-16H,12-13H2,1-3H3/b21-14+,22-15+ |
| InChIKey | LKHFKBBXLACNLG-NNFYUIBOSA-N |
| XLogP | 4.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|