C35H32O3 — CID 17386127
(2Z,6E)-4-methyl-2,6-bis[(4-phenylmethoxyphenyl)methylidene]cyclohexan-1-one (PubChem CID 17386127) has the molecular formula C35H32O3 and a molecular weight of 500.64 g/mol. Its IUPAC name is (2Z,6E)-4-methyl-2,6-bis[(4-phenylmethoxyphenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2Z,6E)-4-methyl-2,6-bis[(4-phenylmethoxyphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 17386127 |
| Molecular Formula | C35H32O3 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | (2Z,6E)-4-methyl-2,6-bis[(4-phenylmethoxyphenyl)methylidene]cyclohexan-1-one |
| SMILES | CC1C/C(=C/c2ccc(OCc3ccccc3)cc2)C(=O)/C(=C/c2ccc(OCc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C35H32O3/c1-26-20-31(22-27-12-16-33(17-13-27)37-24-29-8-4-2-5-9-29)35(36)32(21-26)23-28-14-18-34(19-15-28)38-25-30-10-6-3-7-11-30/h2-19,22-23,26H,20-21,24-25H2,1H3/b31-22-,32-23+ |
| InChIKey | ASXHVOZQFIUVSQ-WQUWKMJHSA-N |
| XLogP | 8.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|