C23H24N2O3S — CID 6079057
(5Z)-2-(2,6-dimethylmorpholin-4-yl)-5-[(4-phenylmethoxyphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 6079057) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is (5Z)-2-(2,6-dimethylmorpholin-4-yl)-5-[(4-phenylmethoxyphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-(2,6-dimethylmorpholin-4-yl)-5-[(4-phenylmethoxyphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 6079057 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (5Z)-2-(2,6-dimethylmorpholin-4-yl)-5-[(4-phenylmethoxyphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | CC1CN(C2=NC(=O)/C(=C/c3ccc(OCc4ccccc4)cc3)S2)CC(C)O1 |
| InChI | InChI=1S/C23H24N2O3S/c1-16-13-25(14-17(2)28-16)23-24-22(26)21(29-23)12-18-8-10-20(11-9-18)27-15-19-6-4-3-5-7-19/h3-12,16-17H,13-15H2,1-2H3/b21-12- |
| InChIKey | SOJZAOVYKAZTPV-MTJSOVHGSA-N |
| XLogP | 4.35 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|