C57H48N2OP2 — CID 102583657
(2E,6E)-4-methyl-2,6-bis[[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]methylidene]cyclohexan-1-one (PubChem CID 102583657) has the molecular formula C57H48N2OP2 and a molecular weight of 838.97 g/mol. Its IUPAC name is (2E,6E)-4-methyl-2,6-bis[[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-4-methyl-2,6-bis[[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 102583657 |
| Molecular Formula | C57H48N2OP2 |
| Molecular Weight | 838.97 g/mol |
| Exact Mass | 838.32 |
| IUPAC Name | (2E,6E)-4-methyl-2,6-bis[[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]methylidene]cyclohexan-1-one |
| SMILES | CC1C/C(=C\c2ccc(N=P(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)C(=O)/C(=C/c2ccc(N=P(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C57H48N2OP2/c1-44-40-47(42-45-32-36-49(37-33-45)58-61(51-20-8-2-9-21-51,52-22-10-3-11-23-52)53-24-12-4-13-25-53)57(60)48(41-44)43-46-34-38-50(39-35-46)59-62(54-26-14-5-15-27-54,55-28-16-6-17-29-55)56-30-18-7-19-31-56/h2-39,42-44H,40-41H2,1H3/b47-42+,48-43+ |
| InChIKey | IGCSHRFENAFVCL-LLGVJSBSSA-N |
| XLogP | 12.77 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.97 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|