C20H18O — CID 92523827
(2E,3R,5Z)-2,5-dibenzylidene-3-methylcyclopentan-1-one (PubChem CID 92523827) has the molecular formula C20H18O and a molecular weight of 274.36 g/mol. Its IUPAC name is (2E,3R,5Z)-2,5-dibenzylidene-3-methylcyclopentan-1-one.
| Compound Name | (2E,3R,5Z)-2,5-dibenzylidene-3-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 92523827 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (2E,3R,5Z)-2,5-dibenzylidene-3-methylcyclopentan-1-one |
| SMILES | C[C@@H]1C/C(=C/c2ccccc2)C(=O)/C1=C/c1ccccc1 |
| InChI | InChI=1S/C20H18O/c1-15-12-18(13-16-8-4-2-5-9-16)20(21)19(15)14-17-10-6-3-7-11-17/h2-11,13-15H,12H2,1H3/b18-13-,19-14+/t15-/m1/s1 |
| InChIKey | UXKDFKBXAPVURZ-IPARKIBGSA-N |
| XLogP | 4.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|