C13H14O — CID 134860997
cis-(2E,3S,4R)-2-benzylidene-3,4-dimethylcyclobutan-1-one (PubChem CID 134860997) has the molecular formula C13H14O and a molecular weight of 186.25 g/mol. Its IUPAC name is cis-(2E,3S,4R)-2-benzylidene-3,4-dimethylcyclobutan-1-one.
| Compound Name | cis-(2E,3S,4R)-2-benzylidene-3,4-dimethylcyclobutan-1-one |
|---|---|
| PubChem CID | 134860997 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | cis-(2E,3S,4R)-2-benzylidene-3,4-dimethylcyclobutan-1-one |
| SMILES | C[C@@H]1/C(=C\c2ccccc2)C(=O)[C@@H]1C |
| InChI | InChI=1S/C13H14O/c1-9-10(2)13(14)12(9)8-11-6-4-3-5-7-11/h3-10H,1-2H3/b12-8+/t9-,10+/m0/s1 |
| InChIKey | SSWPKBNDJCXNCI-FXMSVLPXSA-N |
| XLogP | 2.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|