About (5S)-4,6-dibenzylidene-5-methyl-2-propan-2-ylcyclohex-2-en-1-one
(5S)-4,6-dibenzylidene-5-methyl-2-propan-2-ylcyclohex-2-en-1-one (PubChem CID 7233061) has the molecular formula C24H24O
and a molecular weight of 328.45 g/mol. Its IUPAC name is (5S)-4,6-dibenzylidene-5-methyl-2-propan-2-ylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | (5S)-4,6-dibenzylidene-5-methyl-2-propan-2-ylcyclohex-2-en-1-one |
| PubChem CID | 7233061 |
| Molecular Formula | C24H24O |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (5S)-4,6-dibenzylidene-5-methyl-2-propan-2-ylcyclohex-2-en-1-one |
| SMILES | CC(C)C1=CC(=Cc2ccccc2)[C@H](C)C(=Cc2ccccc2)C1=O |
| InChI | InChI=1S/C24H24O/c1-17(2)22-16-21(14-19-10-6-4-7-11-19)18(3)23(24(22)25)15-20-12-8-5-9-13-20/h4-18H,1-3H3/t18-/m0/s1 |
| InChIKey | GBDBYNWRLLDETJ-SFHVURJKSA-N |
| XLogP | 5.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5S)-4,6-dibenzylidene-5-methyl-2-propan-2-ylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-4,6-dibenzylidene-5-methyl-2-propan-2-ylcyclohex-2-en-1-one?
The IUPAC name of (5S)-4,6-dibenzylidene-5-methyl-2-propan-2-ylcyclohex-2-en-1-one (CID 7233061) is (5S)-4,6-dibenzylidene-5-methyl-2-propan-2-ylcyclohex-2-en-1-one.
What is the SMILES notation for (5S)-4,6-dibenzylidene-5-methyl-2-propan-2-ylcyclohex-2-en-1-one?
The canonical SMILES for (5S)-4,6-dibenzylidene-5-methyl-2-propan-2-ylcyclohex-2-en-1-one is CC(C)C1=CC(=Cc2ccccc2)[C@H](C)C(=Cc2ccccc2)C1=O.
What is the InChIKey of (5S)-4,6-dibenzylidene-5-methyl-2-propan-2-ylcyclohex-2-en-1-one?
The InChIKey is GBDBYNWRLLDETJ-SFHVURJKSA-N. The full InChI is InChI=1S/C24H24O/c1-17(2)22-16-21(14-19-10-6-4-7-11-19)18(3)23(24(22)25)15-20-12-8-5-9-13-20/h4-18H,1-3H3/t18-/m0/s1.
What are the key properties of (5S)-4,6-dibenzylidene-5-methyl-2-propan-2-ylcyclohex-2-en-1-one?
(5S)-4,6-dibenzylidene-5-methyl-2-propan-2-ylcyclohex-2-en-1-one has a molecular weight of 328.45 g/mol, XLogP of 5.95, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-4,6-dibenzylidene-5-methyl-2-propan-2-ylcyclohex-2-en-1-one is sourced from PubChem (CID 7233061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).