C16H16O3 — CID 132551776
3-methyl-4-phenoxy-6-propan-2-ylcyclohexa-3,5-diene-1,2-dione (PubChem CID 132551776) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-methyl-4-phenoxy-6-propan-2-ylcyclohexa-3,5-diene-1,2-dione.
| Compound Name | 3-methyl-4-phenoxy-6-propan-2-ylcyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 132551776 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-methyl-4-phenoxy-6-propan-2-ylcyclohexa-3,5-diene-1,2-dione |
| SMILES | CC1=C(Oc2ccccc2)C=C(C(C)C)C(=O)C1=O |
| InChI | InChI=1S/C16H16O3/c1-10(2)13-9-14(11(3)15(17)16(13)18)19-12-7-5-4-6-8-12/h4-10H,1-3H3 |
| InChIKey | VPWZFEPKHWWKQP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|