About 2-methylpropylalumane;phenoxybenzene
2-methylpropylalumane;phenoxybenzene (PubChem CID 175332476) has the molecular formula C16H21AlO
and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-methylpropylalumane;phenoxybenzene.
Molecular Properties
| Compound Name | 2-methylpropylalumane;phenoxybenzene |
| PubChem CID | 175332476 |
| Molecular Formula | C16H21AlO |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-methylpropylalumane;phenoxybenzene |
| SMILES | CC(C)C[AlH2].c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C4H9.Al.2H/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-4(2)3;;;/h1-10H;4H,1H2,2-3H3;;; |
| InChIKey | DXBCDEACLHHYRC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylpropylalumane;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropylalumane;phenoxybenzene?
The IUPAC name of 2-methylpropylalumane;phenoxybenzene (CID 175332476) is 2-methylpropylalumane;phenoxybenzene.
What is the SMILES notation for 2-methylpropylalumane;phenoxybenzene?
The canonical SMILES for 2-methylpropylalumane;phenoxybenzene is CC(C)C[AlH2].c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 2-methylpropylalumane;phenoxybenzene?
The InChIKey is DXBCDEACLHHYRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C4H9.Al.2H/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-4(2)3;;;/h1-10H;4H,1H2,2-3H3;;;.
What are the key properties of 2-methylpropylalumane;phenoxybenzene?
2-methylpropylalumane;phenoxybenzene has a molecular weight of 256.33 g/mol, XLogP of 4.17, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropylalumane;phenoxybenzene is sourced from PubChem (CID 175332476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).