About 1-(1-hydroxyethylsulfanyl)ethanol;phenoxybenzene
1-(1-hydroxyethylsulfanyl)ethanol;phenoxybenzene (PubChem CID 21117107) has the molecular formula C16H20O3S
and a molecular weight of 292.40 g/mol. Its IUPAC name is 1-(1-hydroxyethylsulfanyl)ethanol;phenoxybenzene.
Molecular Properties
| Compound Name | 1-(1-hydroxyethylsulfanyl)ethanol;phenoxybenzene |
| PubChem CID | 21117107 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-(1-hydroxyethylsulfanyl)ethanol;phenoxybenzene |
| SMILES | CC(O)SC(C)O.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C4H10O2S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(5)7-4(2)6/h1-10H;3-6H,1-2H3 |
| InChIKey | CHIWQEQGLZGZDJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-hydroxyethylsulfanyl)ethanol;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-hydroxyethylsulfanyl)ethanol;phenoxybenzene?
The IUPAC name of 1-(1-hydroxyethylsulfanyl)ethanol;phenoxybenzene (CID 21117107) is 1-(1-hydroxyethylsulfanyl)ethanol;phenoxybenzene.
What is the SMILES notation for 1-(1-hydroxyethylsulfanyl)ethanol;phenoxybenzene?
The canonical SMILES for 1-(1-hydroxyethylsulfanyl)ethanol;phenoxybenzene is CC(O)SC(C)O.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 1-(1-hydroxyethylsulfanyl)ethanol;phenoxybenzene?
The InChIKey is CHIWQEQGLZGZDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C4H10O2S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(5)7-4(2)6/h1-10H;3-6H,1-2H3.
What are the key properties of 1-(1-hydroxyethylsulfanyl)ethanol;phenoxybenzene?
1-(1-hydroxyethylsulfanyl)ethanol;phenoxybenzene has a molecular weight of 292.40 g/mol, XLogP of 3.88, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-hydroxyethylsulfanyl)ethanol;phenoxybenzene is sourced from PubChem (CID 21117107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).