About 3-methylbutan-1-ol;phenoxybenzene
3-methylbutan-1-ol;phenoxybenzene (PubChem CID 175265119) has the molecular formula C17H22O2
and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-methylbutan-1-ol;phenoxybenzene.
Molecular Properties
| Compound Name | 3-methylbutan-1-ol;phenoxybenzene |
| PubChem CID | 175265119 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 3-methylbutan-1-ol;phenoxybenzene |
| SMILES | CC(C)CCO.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C5H12O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5(2)3-4-6/h1-10H;5-6H,3-4H2,1-2H3 |
| InChIKey | OLTQXYHQMCWIDU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylbutan-1-ol;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-1-ol;phenoxybenzene?
The IUPAC name of 3-methylbutan-1-ol;phenoxybenzene (CID 175265119) is 3-methylbutan-1-ol;phenoxybenzene.
What is the SMILES notation for 3-methylbutan-1-ol;phenoxybenzene?
The canonical SMILES for 3-methylbutan-1-ol;phenoxybenzene is CC(C)CCO.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 3-methylbutan-1-ol;phenoxybenzene?
The InChIKey is OLTQXYHQMCWIDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C5H12O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5(2)3-4-6/h1-10H;5-6H,3-4H2,1-2H3.
What are the key properties of 3-methylbutan-1-ol;phenoxybenzene?
3-methylbutan-1-ol;phenoxybenzene has a molecular weight of 258.36 g/mol, XLogP of 4.50, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-1-ol;phenoxybenzene is sourced from PubChem (CID 175265119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).