C19H25NO2 — CID 171261271
(1R,2S)-1-amino-5-methyl-1-(3-phenoxyphenyl)hexan-2-ol (PubChem CID 171261271) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (1R,2S)-1-amino-5-methyl-1-(3-phenoxyphenyl)hexan-2-ol.
| Compound Name | (1R,2S)-1-amino-5-methyl-1-(3-phenoxyphenyl)hexan-2-ol |
|---|---|
| PubChem CID | 171261271 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (1R,2S)-1-amino-5-methyl-1-(3-phenoxyphenyl)hexan-2-ol |
| SMILES | CC(C)CC[C@H](O)[C@H](N)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C19H25NO2/c1-14(2)11-12-18(21)19(20)15-7-6-10-17(13-15)22-16-8-4-3-5-9-16/h3-10,13-14,18-19,21H,11-12,20H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | VNXUXTYQYUWDRB-RBUKOAKNSA-N |
| XLogP | 4.28 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |