C17H20O3 — CID 135050581
(2S,3R,4S)-4-(3-phenoxyphenyl)pentane-2,3-diol (PubChem CID 135050581) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is (2S,3R,4S)-4-(3-phenoxyphenyl)pentane-2,3-diol.
| Compound Name | (2S,3R,4S)-4-(3-phenoxyphenyl)pentane-2,3-diol |
|---|---|
| PubChem CID | 135050581 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (2S,3R,4S)-4-(3-phenoxyphenyl)pentane-2,3-diol |
| SMILES | C[C@H](O)[C@H](O)[C@@H](C)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C17H20O3/c1-12(17(19)13(2)18)14-7-6-10-16(11-14)20-15-8-4-3-5-9-15/h3-13,17-19H,1-2H3/t12-,13-,17+/m0/s1 |
| InChIKey | INEGOSAZKUKHRE-GDZNZVCISA-N |
| XLogP | 3.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |