About 3-methyl-1-(3-methylbutoxy)butane;phenoxybenzene
3-methyl-1-(3-methylbutoxy)butane;phenoxybenzene (PubChem CID 175265120) has the molecular formula C22H32O2
and a molecular weight of 328.50 g/mol. Its IUPAC name is 3-methyl-1-(3-methylbutoxy)butane;phenoxybenzene.
Molecular Properties
| Compound Name | 3-methyl-1-(3-methylbutoxy)butane;phenoxybenzene |
| PubChem CID | 175265120 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 3-methyl-1-(3-methylbutoxy)butane;phenoxybenzene |
| SMILES | CC(C)CCOCCC(C)C.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C10H22O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-9(2)5-7-11-8-6-10(3)4/h1-10H;9-10H,5-8H2,1-4H3 |
| InChIKey | QNFFUZTYAUPRKM-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1-(3-methylbutoxy)butane;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(3-methylbutoxy)butane;phenoxybenzene?
The IUPAC name of 3-methyl-1-(3-methylbutoxy)butane;phenoxybenzene (CID 175265120) is 3-methyl-1-(3-methylbutoxy)butane;phenoxybenzene.
What is the SMILES notation for 3-methyl-1-(3-methylbutoxy)butane;phenoxybenzene?
The canonical SMILES for 3-methyl-1-(3-methylbutoxy)butane;phenoxybenzene is CC(C)CCOCCC(C)C.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 3-methyl-1-(3-methylbutoxy)butane;phenoxybenzene?
The InChIKey is QNFFUZTYAUPRKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C10H22O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-9(2)5-7-11-8-6-10(3)4/h1-10H;9-10H,5-8H2,1-4H3.
What are the key properties of 3-methyl-1-(3-methylbutoxy)butane;phenoxybenzene?
3-methyl-1-(3-methylbutoxy)butane;phenoxybenzene has a molecular weight of 328.50 g/mol, XLogP of 6.57, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(3-methylbutoxy)butane;phenoxybenzene is sourced from PubChem (CID 175265120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).