About ethane-1,2-diol;methanol;phenoxybenzene
ethane-1,2-diol;methanol;phenoxybenzene (PubChem CID 174609290) has the molecular formula C15H20O4
and a molecular weight of 264.32 g/mol. Its IUPAC name is ethane-1,2-diol;methanol;phenoxybenzene.
Molecular Properties
| Compound Name | ethane-1,2-diol;methanol;phenoxybenzene |
| PubChem CID | 174609290 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | ethane-1,2-diol;methanol;phenoxybenzene |
| SMILES | CO.OCCO.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C2H6O2.CH4O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;3-1-2-4;1-2/h1-10H;3-4H,1-2H2;2H,1H3 |
| InChIKey | RNLFZGUNQZSYFC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane-1,2-diol;methanol;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;methanol;phenoxybenzene?
The IUPAC name of ethane-1,2-diol;methanol;phenoxybenzene (CID 174609290) is ethane-1,2-diol;methanol;phenoxybenzene.
What is the SMILES notation for ethane-1,2-diol;methanol;phenoxybenzene?
The canonical SMILES for ethane-1,2-diol;methanol;phenoxybenzene is CO.OCCO.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of ethane-1,2-diol;methanol;phenoxybenzene?
The InChIKey is RNLFZGUNQZSYFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C2H6O2.CH4O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;3-1-2-4;1-2/h1-10H;3-4H,1-2H2;2H,1H3.
What are the key properties of ethane-1,2-diol;methanol;phenoxybenzene?
ethane-1,2-diol;methanol;phenoxybenzene has a molecular weight of 264.32 g/mol, XLogP of 2.06, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;methanol;phenoxybenzene is sourced from PubChem (CID 174609290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).