About isocyanic acid;phenoxybenzene;propane-1,3-diol
isocyanic acid;phenoxybenzene;propane-1,3-diol (PubChem CID 175117319) has the molecular formula C17H20N2O5
and a molecular weight of 332.36 g/mol. Its IUPAC name is isocyanic acid;phenoxybenzene;propane-1,3-diol.
Molecular Properties
| Compound Name | isocyanic acid;phenoxybenzene;propane-1,3-diol |
| PubChem CID | 175117319 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | isocyanic acid;phenoxybenzene;propane-1,3-diol |
| SMILES | N=C=O.N=C=O.OCCCO.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C3H8O2.2CHNO/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;4-2-1-3-5;2*2-1-3/h1-10H;4-5H,1-3H2;2*2H |
| InChIKey | IAPPRCQLTHAXSS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze isocyanic acid;phenoxybenzene;propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanic acid;phenoxybenzene;propane-1,3-diol?
The IUPAC name of isocyanic acid;phenoxybenzene;propane-1,3-diol (CID 175117319) is isocyanic acid;phenoxybenzene;propane-1,3-diol.
What is the SMILES notation for isocyanic acid;phenoxybenzene;propane-1,3-diol?
The canonical SMILES for isocyanic acid;phenoxybenzene;propane-1,3-diol is N=C=O.N=C=O.OCCCO.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of isocyanic acid;phenoxybenzene;propane-1,3-diol?
The InChIKey is IAPPRCQLTHAXSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C3H8O2.2CHNO/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;4-2-1-3-5;2*2-1-3/h1-10H;4-5H,1-3H2;2*2H.
What are the key properties of isocyanic acid;phenoxybenzene;propane-1,3-diol?
isocyanic acid;phenoxybenzene;propane-1,3-diol has a molecular weight of 332.36 g/mol, XLogP of 2.64, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanic acid;phenoxybenzene;propane-1,3-diol is sourced from PubChem (CID 175117319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).