About phenoxybenzene;propane-2,2-diol
phenoxybenzene;propane-2,2-diol (PubChem CID 174556232) has the molecular formula C15H18O3
and a molecular weight of 246.31 g/mol. Its IUPAC name is phenoxybenzene;propane-2,2-diol.
Molecular Properties
| Compound Name | phenoxybenzene;propane-2,2-diol |
| PubChem CID | 174556232 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | phenoxybenzene;propane-2,2-diol |
| SMILES | CC(C)(O)O.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C3H8O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2,4)5/h1-10H;4-5H,1-2H3 |
| InChIKey | NLCGBRGXYVXELV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze phenoxybenzene;propane-2,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenoxybenzene;propane-2,2-diol?
The IUPAC name of phenoxybenzene;propane-2,2-diol (CID 174556232) is phenoxybenzene;propane-2,2-diol.
What is the SMILES notation for phenoxybenzene;propane-2,2-diol?
The canonical SMILES for phenoxybenzene;propane-2,2-diol is CC(C)(O)O.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of phenoxybenzene;propane-2,2-diol?
The InChIKey is NLCGBRGXYVXELV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C3H8O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2,4)5/h1-10H;4-5H,1-2H3.
What are the key properties of phenoxybenzene;propane-2,2-diol?
phenoxybenzene;propane-2,2-diol has a molecular weight of 246.31 g/mol, XLogP of 3.19, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenoxybenzene;propane-2,2-diol is sourced from PubChem (CID 174556232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).