C18H25BO5 — CID 138393559
2,3-dimethylbutane-2,3-diol;(3-phenoxyphenyl)boronic acid (PubChem CID 138393559) has the molecular formula C18H25BO5 and a molecular weight of 332.20 g/mol. Its IUPAC name is 2,3-dimethylbutane-2,3-diol;(3-phenoxyphenyl)boronic acid.
| Compound Name | 2,3-dimethylbutane-2,3-diol;(3-phenoxyphenyl)boronic acid |
|---|---|
| PubChem CID | 138393559 |
| Molecular Formula | C18H25BO5 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 2,3-dimethylbutane-2,3-diol;(3-phenoxyphenyl)boronic acid |
| SMILES | CC(C)(O)C(C)(C)O.OB(O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C12H11BO3.C6H14O2/c14-13(15)10-5-4-8-12(9-10)16-11-6-2-1-3-7-11;1-5(2,7)6(3,4)8/h1-9,14-15H;7-8H,1-4H3 |
| InChIKey | BQHQGIXSMOBNQS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|