C11H20BNO4 — CID 162238895
2,3-dimethylbutane-2,3-diol;pyridin-3-ylboronic acid (PubChem CID 162238895) has the molecular formula C11H20BNO4 and a molecular weight of 241.10 g/mol. Its IUPAC name is 2,3-dimethylbutane-2,3-diol;pyridin-3-ylboronic acid.
| Compound Name | 2,3-dimethylbutane-2,3-diol;pyridin-3-ylboronic acid |
|---|---|
| PubChem CID | 162238895 |
| Molecular Formula | C11H20BNO4 |
| Molecular Weight | 241.10 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2,3-dimethylbutane-2,3-diol;pyridin-3-ylboronic acid |
| SMILES | CC(C)(O)C(C)(C)O.OB(O)c1cccnc1 |
| InChI | InChI=1S/C6H14O2.C5H6BNO2/c1-5(2,7)6(3,4)8;8-6(9)5-2-1-3-7-4-5/h7-8H,1-4H3;1-4,8-9H |
| InChIKey | ZWKZBUNCVZNROQ-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.10 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|