About (4-tert-butylphenyl)boronic acid;3-(4-tert-butylphenyl)pyridine
(4-tert-butylphenyl)boronic acid;3-(4-tert-butylphenyl)pyridine (PubChem CID 165063634) has the molecular formula C25H32BNO2
and a molecular weight of 389.35 g/mol. Its IUPAC name is (4-tert-butylphenyl)boronic acid;3-(4-tert-butylphenyl)pyridine.
Molecular Properties
| Compound Name | (4-tert-butylphenyl)boronic acid;3-(4-tert-butylphenyl)pyridine |
| PubChem CID | 165063634 |
| Molecular Formula | C25H32BNO2 |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | (4-tert-butylphenyl)boronic acid;3-(4-tert-butylphenyl)pyridine |
| SMILES | CC(C)(C)c1ccc(-c2cccnc2)cc1.CC(C)(C)c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C15H17N.C10H15BO2/c1-15(2,3)14-8-6-12(7-9-14)13-5-4-10-16-11-13;1-10(2,3)8-4-6-9(7-5-8)11(12)13/h4-11H,1-3H3;4-7,12-13H,1-3H3 |
| InChIKey | RPLXEGLREVHEGX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-tert-butylphenyl)boronic acid;3-(4-tert-butylphenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylphenyl)boronic acid;3-(4-tert-butylphenyl)pyridine?
The IUPAC name of (4-tert-butylphenyl)boronic acid;3-(4-tert-butylphenyl)pyridine (CID 165063634) is (4-tert-butylphenyl)boronic acid;3-(4-tert-butylphenyl)pyridine.
What is the SMILES notation for (4-tert-butylphenyl)boronic acid;3-(4-tert-butylphenyl)pyridine?
The canonical SMILES for (4-tert-butylphenyl)boronic acid;3-(4-tert-butylphenyl)pyridine is CC(C)(C)c1ccc(-c2cccnc2)cc1.CC(C)(C)c1ccc(B(O)O)cc1.
What is the InChIKey of (4-tert-butylphenyl)boronic acid;3-(4-tert-butylphenyl)pyridine?
The InChIKey is RPLXEGLREVHEGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N.C10H15BO2/c1-15(2,3)14-8-6-12(7-9-14)13-5-4-10-16-11-13;1-10(2,3)8-4-6-9(7-5-8)11(12)13/h4-11H,1-3H3;4-7,12-13H,1-3H3.
What are the key properties of (4-tert-butylphenyl)boronic acid;3-(4-tert-butylphenyl)pyridine?
(4-tert-butylphenyl)boronic acid;3-(4-tert-butylphenyl)pyridine has a molecular weight of 389.35 g/mol, XLogP of 4.71, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylphenyl)boronic acid;3-(4-tert-butylphenyl)pyridine is sourced from PubChem (CID 165063634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).