About bis(2-methylpropane);3-pyridin-3-ylpyridine
bis(2-methylpropane);3-pyridin-3-ylpyridine (PubChem CID 158581875) has the molecular formula C18H28N2
and a molecular weight of 272.44 g/mol. Its IUPAC name is bis(2-methylpropane);3-pyridin-3-ylpyridine.
Molecular Properties
| Compound Name | bis(2-methylpropane);3-pyridin-3-ylpyridine |
| PubChem CID | 158581875 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | bis(2-methylpropane);3-pyridin-3-ylpyridine |
| SMILES | CC(C)C.CC(C)C.c1cncc(-c2cccnc2)c1 |
| InChI | InChI=1S/C10H8N2.2C4H10/c1-3-9(7-11-5-1)10-4-2-6-12-8-10;2*1-4(2)3/h1-8H;2*4H,1-3H3 |
| InChIKey | HTIRKORWGHUUDW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(2-methylpropane);3-pyridin-3-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylpropane);3-pyridin-3-ylpyridine?
The IUPAC name of bis(2-methylpropane);3-pyridin-3-ylpyridine (CID 158581875) is bis(2-methylpropane);3-pyridin-3-ylpyridine.
What is the SMILES notation for bis(2-methylpropane);3-pyridin-3-ylpyridine?
The canonical SMILES for bis(2-methylpropane);3-pyridin-3-ylpyridine is CC(C)C.CC(C)C.c1cncc(-c2cccnc2)c1.
What is the InChIKey of bis(2-methylpropane);3-pyridin-3-ylpyridine?
The InChIKey is HTIRKORWGHUUDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.2C4H10/c1-3-9(7-11-5-1)10-4-2-6-12-8-10;2*1-4(2)3/h1-8H;2*4H,1-3H3.
What are the key properties of bis(2-methylpropane);3-pyridin-3-ylpyridine?
bis(2-methylpropane);3-pyridin-3-ylpyridine has a molecular weight of 272.44 g/mol, XLogP of 5.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpropane);3-pyridin-3-ylpyridine is sourced from PubChem (CID 158581875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).