About CID 141390156
CID 141390156 (PubChem CID 141390156) has the molecular formula C11H8NSi
and a molecular weight of 182.28 g/mol.
Molecular Properties
| Compound Name | CID 141390156 |
| PubChem CID | 141390156 |
| Molecular Formula | C11H8NSi |
| Molecular Weight | 182.28 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | — |
| SMILES | [Si]c1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C11H8NSi/c13-11-5-3-9(4-6-11)10-2-1-7-12-8-10/h1-8H |
| InChIKey | OOLJWABZKVFQFC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 141390156 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 141390156?
The IUPAC name of CID 141390156 (CID 141390156) is not available.
What is the SMILES notation for CID 141390156?
The canonical SMILES for CID 141390156 is [Si]c1ccc(-c2cccnc2)cc1.
What is the InChIKey of CID 141390156?
The InChIKey is OOLJWABZKVFQFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8NSi/c13-11-5-3-9(4-6-11)10-2-1-7-12-8-10/h1-8H.
What are the key properties of CID 141390156?
CID 141390156 has a molecular weight of 182.28 g/mol, XLogP of 1.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 141390156 is sourced from PubChem (CID 141390156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).