About CID 147291067
CID 147291067 (PubChem CID 147291067) has the molecular formula C11H9BNO
and a molecular weight of 182.01 g/mol.
Molecular Properties
| Compound Name | CID 147291067 |
| PubChem CID | 147291067 |
| Molecular Formula | C11H9BNO |
| Molecular Weight | 182.01 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | — |
| SMILES | O[B]c1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C11H9BNO/c14-12-11-5-3-9(4-6-11)10-2-1-7-13-8-10/h1-8,14H |
| InChIKey | LDWNNEKNNPTIES-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.01 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 147291067 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 147291067?
The IUPAC name of CID 147291067 (CID 147291067) is not available.
What is the SMILES notation for CID 147291067?
The canonical SMILES for CID 147291067 is O[B]c1ccc(-c2cccnc2)cc1.
What is the InChIKey of CID 147291067?
The InChIKey is LDWNNEKNNPTIES-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BNO/c14-12-11-5-3-9(4-6-11)10-2-1-7-13-8-10/h1-8,14H.
What are the key properties of CID 147291067?
CID 147291067 has a molecular weight of 182.01 g/mol, XLogP of 0.99, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 147291067 is sourced from PubChem (CID 147291067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).