C11H20BNO5 — CID 174682571
boric acid;2,3-dimethyl-3-pyridin-3-yloxybutan-2-ol (PubChem CID 174682571) has the molecular formula C11H20BNO5 and a molecular weight of 257.09 g/mol. Its IUPAC name is boric acid;2,3-dimethyl-3-pyridin-3-yloxybutan-2-ol.
| Compound Name | boric acid;2,3-dimethyl-3-pyridin-3-yloxybutan-2-ol |
|---|---|
| PubChem CID | 174682571 |
| Molecular Formula | C11H20BNO5 |
| Molecular Weight | 257.09 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | boric acid;2,3-dimethyl-3-pyridin-3-yloxybutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)Oc1cccnc1.OB(O)O |
| InChI | InChI=1S/C11H17NO2.BH3O3/c1-10(2,13)11(3,4)14-9-6-5-7-12-8-9;2-1(3)4/h5-8,13H,1-4H3;2-4H |
| InChIKey | XRRGGSASYISGTE-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.09 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|