C20H35NO3 — CID 146506619
3-[2-methyl-5-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxypentan-2-yl]oxypyridine (PubChem CID 146506619) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is 3-[2-methyl-5-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxypentan-2-yl]oxypyridine.
| Compound Name | 3-[2-methyl-5-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxypentan-2-yl]oxypyridine |
|---|---|
| PubChem CID | 146506619 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | 3-[2-methyl-5-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxypentan-2-yl]oxypyridine |
| SMILES | CC(C)(C)OCCC(C)(C)OCCCC(C)(C)Oc1cccnc1 |
| InChI | InChI=1S/C20H35NO3/c1-18(2,3)22-15-12-19(4,5)23-14-9-11-20(6,7)24-17-10-8-13-21-16-17/h8,10,13,16H,9,11-12,14-15H2,1-7H3 |
| InChIKey | PGASCUDYTSDEJK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|