C17H27NO4 — CID 137444763
3-[4-(4-amino-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]oxybenzoic acid (PubChem CID 137444763) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 3-[4-(4-amino-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]oxybenzoic acid.
| Compound Name | 3-[4-(4-amino-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 137444763 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 3-[4-(4-amino-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]oxybenzoic acid |
| SMILES | CC(C)(CCN)OCCC(C)(C)Oc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H27NO4/c1-16(2,8-10-18)21-11-9-17(3,4)22-14-7-5-6-13(12-14)15(19)20/h5-7,12H,8-11,18H2,1-4H3,(H,19,20) |
| InChIKey | IBOFQBNBGACRSW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |