C28H48N2O5 — CID 167108281
tert-butyl 8-[4-[4-(4-amino-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]oxyanilino]-8-oxooctanoate (PubChem CID 167108281) has the molecular formula C28H48N2O5 and a molecular weight of 492.70 g/mol. Its IUPAC name is tert-butyl 8-[4-[4-(4-amino-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]oxyanilino]-8-oxooctanoate.
| Compound Name | tert-butyl 8-[4-[4-(4-amino-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]oxyanilino]-8-oxooctanoate |
|---|---|
| PubChem CID | 167108281 |
| Molecular Formula | C28H48N2O5 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.36 |
| IUPAC Name | tert-butyl 8-[4-[4-(4-amino-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]oxyanilino]-8-oxooctanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCCC(=O)Nc1ccc(OC(C)(C)CCOC(C)(C)CCN)cc1 |
| InChI | InChI=1S/C28H48N2O5/c1-26(2,3)35-25(32)13-11-9-8-10-12-24(31)30-22-14-16-23(17-15-22)34-28(6,7)19-21-33-27(4,5)18-20-29/h14-17H,8-13,18-21,29H2,1-7H3,(H,30,31) |
| InChIKey | CDOVIEATYCYHMC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|