C20H34N2O3 — CID 166947124
4-[3-(2-aminoethoxy)-3-methylbutoxy]-4-methyl-N-(4-methylphenyl)pentanamide (PubChem CID 166947124) has the molecular formula C20H34N2O3 and a molecular weight of 350.50 g/mol. Its IUPAC name is 4-[3-(2-aminoethoxy)-3-methylbutoxy]-4-methyl-N-(4-methylphenyl)pentanamide.
| Compound Name | 4-[3-(2-aminoethoxy)-3-methylbutoxy]-4-methyl-N-(4-methylphenyl)pentanamide |
|---|---|
| PubChem CID | 166947124 |
| Molecular Formula | C20H34N2O3 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | 4-[3-(2-aminoethoxy)-3-methylbutoxy]-4-methyl-N-(4-methylphenyl)pentanamide |
| SMILES | Cc1ccc(NC(=O)CCC(C)(C)OCCC(C)(C)OCCN)cc1 |
| InChI | InChI=1S/C20H34N2O3/c1-16-6-8-17(9-7-16)22-18(23)10-11-19(2,3)24-14-12-20(4,5)25-15-13-21/h6-9H,10-15,21H2,1-5H3,(H,22,23) |
| InChIKey | BJLAMAQLDWIMDZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |