C27H41N3O6 — CID 159993199
2-(2-aminoethoxy)-N-phenylacetamide;tert-butyl 4-(2-anilino-2-oxoethoxy)butanoate;methane (PubChem CID 159993199) has the molecular formula C27H41N3O6 and a molecular weight of 503.64 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N-phenylacetamide;tert-butyl 4-(2-anilino-2-oxoethoxy)butanoate;methane.
| Compound Name | 2-(2-aminoethoxy)-N-phenylacetamide;tert-butyl 4-(2-anilino-2-oxoethoxy)butanoate;methane |
|---|---|
| PubChem CID | 159993199 |
| Molecular Formula | C27H41N3O6 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | 2-(2-aminoethoxy)-N-phenylacetamide;tert-butyl 4-(2-anilino-2-oxoethoxy)butanoate;methane |
| SMILES | C.CC(C)(C)OC(=O)CCCOCC(=O)Nc1ccccc1.NCCOCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H23NO4.C10H14N2O2.CH4/c1-16(2,3)21-15(19)10-7-11-20-12-14(18)17-13-8-5-4-6-9-13;11-6-7-14-8-10(13)12-9-4-2-1-3-5-9;/h4-6,8-9H,7,10-12H2,1-3H3,(H,17,18);1-5H,6-8,11H2,(H,12,13);1H4 |
| InChIKey | OHFDFKRLJONBON-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|