C30H43N5O7 — CID 91463734
tert-butyl N-[4-[[5-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-6-anilino-6-oxohexyl]carbamoyl]phenyl]carbamate (PubChem CID 91463734) has the molecular formula C30H43N5O7 and a molecular weight of 585.70 g/mol. Its IUPAC name is tert-butyl N-[4-[[5-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-6-anilino-6-oxohexyl]carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[5-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-6-anilino-6-oxohexyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 91463734 |
| Molecular Formula | C30H43N5O7 |
| Molecular Weight | 585.70 g/mol |
| Exact Mass | 585.32 |
| IUPAC Name | tert-butyl N-[4-[[5-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-6-anilino-6-oxohexyl]carbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)NCCCCC(NC(=O)COCCOCCN)C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C30H43N5O7/c1-30(2,3)42-29(39)34-24-14-12-22(13-15-24)27(37)32-17-8-7-11-25(28(38)33-23-9-5-4-6-10-23)35-26(36)21-41-20-19-40-18-16-31/h4-6,9-10,12-15,25H,7-8,11,16-21,31H2,1-3H3,(H,32,37)(H,33,38)(H,34,39)(H,35,36) |
| InChIKey | KJLQFRNLEYKIFY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 170.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|