C31H52N4O8 — CID 159512413
N-[(5S)-6-amino-5-[[2-[2-[5-(2-butoxyethoxy)-4-oxopentoxy]ethoxy]acetyl]amino]-6-oxohexyl]-4-(propylamino)benzamide (PubChem CID 159512413) has the molecular formula C31H52N4O8 and a molecular weight of 608.78 g/mol. Its IUPAC name is N-[(5S)-6-amino-5-[[2-[2-[5-(2-butoxyethoxy)-4-oxopentoxy]ethoxy]acetyl]amino]-6-oxohexyl]-4-(propylamino)benzamide.
| Compound Name | N-[(5S)-6-amino-5-[[2-[2-[5-(2-butoxyethoxy)-4-oxopentoxy]ethoxy]acetyl]amino]-6-oxohexyl]-4-(propylamino)benzamide |
|---|---|
| PubChem CID | 159512413 |
| Molecular Formula | C31H52N4O8 |
| Molecular Weight | 608.78 g/mol |
| Exact Mass | 608.38 |
| IUPAC Name | N-[(5S)-6-amino-5-[[2-[2-[5-(2-butoxyethoxy)-4-oxopentoxy]ethoxy]acetyl]amino]-6-oxohexyl]-4-(propylamino)benzamide |
| SMILES | CCCCOCCOCC(=O)CCCOCCOCC(=O)N[C@@H](CCCCNC(=O)c1ccc(NCCC)cc1)C(N)=O |
| InChI | InChI=1S/C31H52N4O8/c1-3-5-17-40-19-21-42-23-27(36)9-8-18-41-20-22-43-24-29(37)35-28(30(32)38)10-6-7-16-34-31(39)25-11-13-26(14-12-25)33-15-4-2/h11-14,28,33H,3-10,15-24H2,1-2H3,(H2,32,38)(H,34,39)(H,35,37)/t28-/m0/s1 |
| InChIKey | BIABBDYZOCDZJX-NDEPHWFRSA-N |
| XLogP | 2.59 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.78 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|