C17H34N2O4 — CID 153389526
(2R)-2-[[2-(2-butoxyethoxy)acetyl]amino]-7-methyloctanamide (PubChem CID 153389526) has the molecular formula C17H34N2O4 and a molecular weight of 330.47 g/mol. Its IUPAC name is (2R)-2-[[2-(2-butoxyethoxy)acetyl]amino]-7-methyloctanamide.
| Compound Name | (2R)-2-[[2-(2-butoxyethoxy)acetyl]amino]-7-methyloctanamide |
|---|---|
| PubChem CID | 153389526 |
| Molecular Formula | C17H34N2O4 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | (2R)-2-[[2-(2-butoxyethoxy)acetyl]amino]-7-methyloctanamide |
| SMILES | CCCCOCCOCC(=O)N[C@H](CCCCC(C)C)C(N)=O |
| InChI | InChI=1S/C17H34N2O4/c1-4-5-10-22-11-12-23-13-16(20)19-15(17(18)21)9-7-6-8-14(2)3/h14-15H,4-13H2,1-3H3,(H2,18,21)(H,19,20)/t15-/m1/s1 |
| InChIKey | RSYTYEQRVHJMER-OAHLLOKOSA-N |
| XLogP | 2.01 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|