C16H34N3O6+ — CID 140598484
[(5S)-6-methoxy-5-[[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]acetyl]amino]-6-oxohexyl]azanium (PubChem CID 140598484) has the molecular formula C16H34N3O6+ and a molecular weight of 364.46 g/mol. Its IUPAC name is [(5S)-6-methoxy-5-[[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]acetyl]amino]-6-oxohexyl]azanium.
| Compound Name | [(5S)-6-methoxy-5-[[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]acetyl]amino]-6-oxohexyl]azanium |
|---|---|
| PubChem CID | 140598484 |
| Molecular Formula | C16H34N3O6+ |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | [(5S)-6-methoxy-5-[[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]acetyl]amino]-6-oxohexyl]azanium |
| SMILES | CNCCOCCOCCOCC(=O)N[C@@H](CCCC[NH3+])C(=O)OC |
| InChI | InChI=1S/C16H33N3O6/c1-18-7-8-23-9-10-24-11-12-25-13-15(20)19-14(16(21)22-2)5-3-4-6-17/h14,18H,3-13,17H2,1-2H3,(H,19,20)/p+1/t14-/m0/s1 |
| InChIKey | BZOSIVBZJPQRTK-AWEZNQCLSA-O |
| XLogP | -1.67 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|