C15H29N3O6 — CID 139325563
6-[(2-aminoacetyl)amino]-2-[[2-(2-propoxyethoxy)acetyl]amino]hexanoic acid (PubChem CID 139325563) has the molecular formula C15H29N3O6 and a molecular weight of 347.41 g/mol. Its IUPAC name is 6-[(2-aminoacetyl)amino]-2-[[2-(2-propoxyethoxy)acetyl]amino]hexanoic acid.
| Compound Name | 6-[(2-aminoacetyl)amino]-2-[[2-(2-propoxyethoxy)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 139325563 |
| Molecular Formula | C15H29N3O6 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 6-[(2-aminoacetyl)amino]-2-[[2-(2-propoxyethoxy)acetyl]amino]hexanoic acid |
| SMILES | CCCOCCOCC(=O)NC(CCCCNC(=O)CN)C(=O)O |
| InChI | InChI=1S/C15H29N3O6/c1-2-7-23-8-9-24-11-14(20)18-12(15(21)22)5-3-4-6-17-13(19)10-16/h12H,2-11,16H2,1H3,(H,17,19)(H,18,20)(H,21,22) |
| InChIKey | KEDDDVMGYKNDRS-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|