C19H35N3O10 — CID 87961234
6-[[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetyl]amino]-2-[(1,3-dimethoxy-1,3-dioxopropan-2-yl)amino]hexanoic acid (PubChem CID 87961234) has the molecular formula C19H35N3O10 and a molecular weight of 465.50 g/mol. Its IUPAC name is 6-[[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetyl]amino]-2-[(1,3-dimethoxy-1,3-dioxopropan-2-yl)amino]hexanoic acid.
| Compound Name | 6-[[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetyl]amino]-2-[(1,3-dimethoxy-1,3-dioxopropan-2-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 87961234 |
| Molecular Formula | C19H35N3O10 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 6-[[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetyl]amino]-2-[(1,3-dimethoxy-1,3-dioxopropan-2-yl)amino]hexanoic acid |
| SMILES | COC(=O)C(NC(CCCCNC(=O)COCCOCCOCCN)C(=O)O)C(=O)OC |
| InChI | InChI=1S/C19H35N3O10/c1-28-18(26)16(19(27)29-2)22-14(17(24)25)5-3-4-7-21-15(23)13-32-12-11-31-10-9-30-8-6-20/h14,16,22H,3-13,20H2,1-2H3,(H,21,23)(H,24,25) |
| InChIKey | LTINYNTURQVJKT-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 184.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|