C26H53N9O9 — CID 129175533
(2S)-2,6-bis[[2-(2-aminoethoxy)acetyl]amino]-N-[(2S)-6-[[2-(2-aminoethoxy)acetyl]amino]-1-(2-aminooxyethylamino)-1-oxohexan-2-yl]hexanamide (PubChem CID 129175533) has the molecular formula C26H53N9O9 and a molecular weight of 635.76 g/mol. Its IUPAC name is (2S)-2,6-bis[[2-(2-aminoethoxy)acetyl]amino]-N-[(2S)-6-[[2-(2-aminoethoxy)acetyl]amino]-1-(2-aminooxyethylamino)-1-oxohexan-2-yl]hexanamide.
| Compound Name | (2S)-2,6-bis[[2-(2-aminoethoxy)acetyl]amino]-N-[(2S)-6-[[2-(2-aminoethoxy)acetyl]amino]-1-(2-aminooxyethylamino)-1-oxohexan-2-yl]hexanamide |
|---|---|
| PubChem CID | 129175533 |
| Molecular Formula | C26H53N9O9 |
| Molecular Weight | 635.76 g/mol |
| Exact Mass | 635.40 |
| IUPAC Name | (2S)-2,6-bis[[2-(2-aminoethoxy)acetyl]amino]-N-[(2S)-6-[[2-(2-aminoethoxy)acetyl]amino]-1-(2-aminooxyethylamino)-1-oxohexan-2-yl]hexanamide |
| SMILES | NCCOCC(=O)NCCCC[C@H](NC(=O)COCCN)C(=O)N[C@@H](CCCCNC(=O)COCCN)C(=O)NCCON |
| InChI | InChI=1S/C26H53N9O9/c27-7-13-41-17-22(36)31-10-3-1-5-20(25(39)33-12-16-44-30)35-26(40)21(34-24(38)19-43-15-9-29)6-2-4-11-32-23(37)18-42-14-8-28/h20-21H,1-19,27-30H2,(H,31,36)(H,32,37)(H,33,39)(H,34,38)(H,35,40)/t20-,21-/m0/s1 |
| InChIKey | WIFHOPBMYAQFAC-SFTDATJTSA-N |
| XLogP | -4.54 |
| TPSA | 286.50 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.76 |
| LogP ≤ 5 | -4.54 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|