C16H31N3O5 — CID 159839160
N-butyl-2,6-bis[(2-methoxyacetyl)amino]hexanamide (PubChem CID 159839160) has the molecular formula C16H31N3O5 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-butyl-2,6-bis[(2-methoxyacetyl)amino]hexanamide.
| Compound Name | N-butyl-2,6-bis[(2-methoxyacetyl)amino]hexanamide |
|---|---|
| PubChem CID | 159839160 |
| Molecular Formula | C16H31N3O5 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | N-butyl-2,6-bis[(2-methoxyacetyl)amino]hexanamide |
| SMILES | CCCCNC(=O)C(CCCCNC(=O)COC)NC(=O)COC |
| InChI | InChI=1S/C16H31N3O5/c1-4-5-9-18-16(22)13(19-15(21)12-24-3)8-6-7-10-17-14(20)11-23-2/h13H,4-12H2,1-3H3,(H,17,20)(H,18,22)(H,19,21) |
| InChIKey | NOLRVMIVAISTLA-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|