C18H37NO2 — CID 167202084
2-methoxy-N-(3-pentyldecyl)acetamide (PubChem CID 167202084) has the molecular formula C18H37NO2 and a molecular weight of 299.50 g/mol. Its IUPAC name is 2-methoxy-N-(3-pentyldecyl)acetamide.
| Compound Name | 2-methoxy-N-(3-pentyldecyl)acetamide |
|---|---|
| PubChem CID | 167202084 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | 2-methoxy-N-(3-pentyldecyl)acetamide |
| SMILES | CCCCCCCC(CCCCC)CCNC(=O)COC |
| InChI | InChI=1S/C18H37NO2/c1-4-6-8-9-11-13-17(12-10-7-5-2)14-15-19-18(20)16-21-3/h17H,4-16H2,1-3H3,(H,19,20) |
| InChIKey | DHZOEGPUNKUZSC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|